C16H18N4O4S2 — CID 2204943
N-[4-[[(4-methoxyphenyl)carbamothioylamino]sulfamoyl]phenyl]acetamide (PubChem CID 2204943) has the molecular formula C16H18N4O4S2 and a molecular weight of 394.48 g/mol. Its IUPAC name is N-[4-[[(4-methoxyphenyl)carbamothioylamino]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-[[(4-methoxyphenyl)carbamothioylamino]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 2204943 |
| Molecular Formula | C16H18N4O4S2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | N-[4-[[(4-methoxyphenyl)carbamothioylamino]sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(NC(=S)NNS(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C16H18N4O4S2/c1-11(21)17-12-5-9-15(10-6-12)26(22,23)20-19-16(25)18-13-3-7-14(24-2)8-4-13/h3-10,20H,1-2H3,(H,17,21)(H2,18,19,25) |
| InChIKey | DSPJOVJPXJFQTL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|