C17H11F6N5O2S2 — CID 56601076
1-[4-[3,5-bis(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]sulfonyl-3-phenylthiourea (PubChem CID 56601076) has the molecular formula C17H11F6N5O2S2 and a molecular weight of 495.43 g/mol. Its IUPAC name is 1-[4-[3,5-bis(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]sulfonyl-3-phenylthiourea.
| Compound Name | 1-[4-[3,5-bis(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]sulfonyl-3-phenylthiourea |
|---|---|
| PubChem CID | 56601076 |
| Molecular Formula | C17H11F6N5O2S2 |
| Molecular Weight | 495.43 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | 1-[4-[3,5-bis(trifluoromethyl)-1,2,4-triazol-4-yl]phenyl]sulfonyl-3-phenylthiourea |
| SMILES | O=S(=O)(NC(=S)Nc1ccccc1)c1ccc(-n2c(C(F)(F)F)nnc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11F6N5O2S2/c18-16(19,20)13-25-26-14(17(21,22)23)28(13)11-6-8-12(9-7-11)32(29,30)27-15(31)24-10-4-2-1-3-5-10/h1-9H,(H2,24,27,31) |
| InChIKey | PXZBEKWUOUPSHM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|