C26H21N5O2S2 — CID 155810324
1-[4-(2-acridin-9-ylhydrazinyl)phenyl]sulfonyl-3-phenylthiourea (PubChem CID 155810324) has the molecular formula C26H21N5O2S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 1-[4-(2-acridin-9-ylhydrazinyl)phenyl]sulfonyl-3-phenylthiourea.
| Compound Name | 1-[4-(2-acridin-9-ylhydrazinyl)phenyl]sulfonyl-3-phenylthiourea |
|---|---|
| PubChem CID | 155810324 |
| Molecular Formula | C26H21N5O2S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 1-[4-(2-acridin-9-ylhydrazinyl)phenyl]sulfonyl-3-phenylthiourea |
| SMILES | O=S(=O)(NC(=S)Nc1ccccc1)c1ccc(NNc2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C26H21N5O2S2/c32-35(33,31-26(34)27-18-8-2-1-3-9-18)20-16-14-19(15-17-20)29-30-25-21-10-4-6-12-23(21)28-24-13-7-5-11-22(24)25/h1-17,29H,(H,28,30)(H2,27,31,34) |
| InChIKey | NRQFUNDPVJETME-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|