C17H17N5O2S2 — CID 25039561
1-ethyl-3-[4-(quinoxalin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 25039561) has the molecular formula C17H17N5O2S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 1-ethyl-3-[4-(quinoxalin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-ethyl-3-[4-(quinoxalin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25039561 |
| Molecular Formula | C17H17N5O2S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 1-ethyl-3-[4-(quinoxalin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | CCNC(=S)Nc1ccc(S(=O)(=O)Nc2cnc3ccccc3n2)cc1 |
| InChI | InChI=1S/C17H17N5O2S2/c1-2-18-17(25)20-12-7-9-13(10-8-12)26(23,24)22-16-11-19-14-5-3-4-6-15(14)21-16/h3-11H,2H2,1H3,(H,21,22)(H2,18,20,25) |
| InChIKey | DHMLGXFEKGMYQT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|