C25H23N5O6S2 — CID 2396638
3,4,5-trimethoxy-N-[[4-(quinoxalin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 2396638) has the molecular formula C25H23N5O6S2 and a molecular weight of 553.62 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[[4-(quinoxalin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[[4-(quinoxalin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2396638 |
| Molecular Formula | C25H23N5O6S2 |
| Molecular Weight | 553.62 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | 3,4,5-trimethoxy-N-[[4-(quinoxalin-2-ylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3cnc4ccccc4n3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H23N5O6S2/c1-34-20-12-15(13-21(35-2)23(20)36-3)24(31)29-25(37)27-16-8-10-17(11-9-16)38(32,33)30-22-14-26-18-6-4-5-7-19(18)28-22/h4-14H,1-3H3,(H,28,30)(H2,27,29,31,37) |
| InChIKey | FHUOHTVEPLLRLI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 140.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|