C24H25N3O5S2 — CID 89089806
3-methoxy-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4,5-dimethylbenzamide (PubChem CID 89089806) has the molecular formula C24H25N3O5S2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 3-methoxy-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4,5-dimethylbenzamide.
| Compound Name | 3-methoxy-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4,5-dimethylbenzamide |
|---|---|
| PubChem CID | 89089806 |
| Molecular Formula | C24H25N3O5S2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 3-methoxy-N-[[4-[(4-methoxyphenyl)sulfamoyl]phenyl]carbamothioyl]-4,5-dimethylbenzamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cc(C)c(C)c(OC)c3)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O5S2/c1-15-13-17(14-22(32-4)16(15)2)23(28)26-24(33)25-18-7-11-21(12-8-18)34(29,30)27-19-5-9-20(31-3)10-6-19/h5-14,27H,1-4H3,(H2,25,26,28,33) |
| InChIKey | BLRTWNDJAXLRMS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|