C28H27N5O5S2 — CID 4953011
N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide (PubChem CID 4953011) has the molecular formula C28H27N5O5S2 and a molecular weight of 577.69 g/mol. Its IUPAC name is N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4953011 |
| Molecular Formula | C28H27N5O5S2 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.15 |
| IUPAC Name | N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-(2-phenoxyethoxy)benzamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(OCCOc4ccccc4)cc3)cc2)n1 |
| InChI | InChI=1S/C28H27N5O5S2/c1-19-18-20(2)30-27(29-19)33-40(35,36)25-14-10-22(11-15-25)31-28(39)32-26(34)21-8-12-24(13-9-21)38-17-16-37-23-6-4-3-5-7-23/h3-15,18H,16-17H2,1-2H3,(H,29,30,33)(H2,31,32,34,39) |
| InChIKey | FBKNQEGUMVXVHB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|