C20H21N5O5S2 — CID 2207623
1-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea (PubChem CID 2207623) has the molecular formula C20H21N5O5S2 and a molecular weight of 475.55 g/mol. Its IUPAC name is 1-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea.
| Compound Name | 1-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2207623 |
| Molecular Formula | C20H21N5O5S2 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 1-[4-(pyrimidin-2-ylsulfamoyl)phenyl]-3-(3,4,5-trimethoxyphenyl)thiourea |
| SMILES | COc1cc(NC(=S)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N5O5S2/c1-28-16-11-14(12-17(29-2)18(16)30-3)24-20(31)23-13-5-7-15(8-6-13)32(26,27)25-19-21-9-4-10-22-19/h4-12H,1-3H3,(H,21,22,25)(H2,23,24,31) |
| InChIKey | HDEIMOOPBMIRRG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|