C16H20N6O4S2 — CID 17378668
tert-butyl N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioylamino]carbamate (PubChem CID 17378668) has the molecular formula C16H20N6O4S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is tert-butyl N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioylamino]carbamate.
| Compound Name | tert-butyl N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioylamino]carbamate |
|---|---|
| PubChem CID | 17378668 |
| Molecular Formula | C16H20N6O4S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | tert-butyl N-[[4-(pyrimidin-2-ylsulfamoyl)phenyl]carbamothioylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=S)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C16H20N6O4S2/c1-16(2,3)26-15(23)21-20-14(27)19-11-5-7-12(8-6-11)28(24,25)22-13-17-9-4-10-18-13/h4-10H,1-3H3,(H,21,23)(H,17,18,22)(H2,19,20,27) |
| InChIKey | UWLPTUUPCXSJOD-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|