C18H19N9O6S2 — CID 2211393
1-[[(2S)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 2211393) has the molecular formula C18H19N9O6S2 and a molecular weight of 521.54 g/mol. Its IUPAC name is 1-[[(2S)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[[(2S)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2211393 |
| Molecular Formula | C18H19N9O6S2 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.09 |
| IUPAC Name | 1-[[(2S)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | COc1nn([C@@H](C)C(=O)NNC(=S)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N9O6S2/c1-11(26-10-14(27(29)30)16(24-26)33-2)15(28)22-23-18(34)21-12-4-6-13(7-5-12)35(31,32)25-17-19-8-3-9-20-17/h3-11H,1-2H3,(H,22,28)(H,19,20,25)(H2,21,23,34)/t11-/m0/s1 |
| InChIKey | WWHARUBKJHOTOI-NSHDSACASA-N |
| XLogP | 0.97 |
| TPSA | 195.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|