C16H18N6O7 — CID 42561442
methyl 2-[[[(2R)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]carbamoylamino]benzoate (PubChem CID 42561442) has the molecular formula C16H18N6O7 and a molecular weight of 406.36 g/mol. Its IUPAC name is methyl 2-[[[(2R)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]carbamoylamino]benzoate.
| Compound Name | methyl 2-[[[(2R)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 42561442 |
| Molecular Formula | C16H18N6O7 |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | methyl 2-[[[(2R)-2-(3-methoxy-4-nitropyrazol-1-yl)propanoyl]amino]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)NNC(=O)[C@@H](C)n1cc([N+](=O)[O-])c(OC)n1 |
| InChI | InChI=1S/C16H18N6O7/c1-9(21-8-12(22(26)27)14(20-21)28-2)13(23)18-19-16(25)17-11-7-5-4-6-10(11)15(24)29-3/h4-9H,1-3H3,(H,18,23)(H2,17,19,25)/t9-/m1/s1 |
| InChIKey | DGAYIVDOEFHFQX-SECBINFHSA-N |
| XLogP | 1.00 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|