C15H15F3N6O4S — CID 2955227
1-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-3-[2-(trifluoromethyl)phenyl]thiourea (PubChem CID 2955227) has the molecular formula C15H15F3N6O4S and a molecular weight of 432.38 g/mol. Its IUPAC name is 1-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-3-[2-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2955227 |
| Molecular Formula | C15H15F3N6O4S |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 1-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]-3-[2-(trifluoromethyl)phenyl]thiourea |
| SMILES | COc1nn(C(C)C(=O)NNC(=S)Nc2ccccc2C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15F3N6O4S/c1-8(23-7-11(24(26)27)13(22-23)28-2)12(25)20-21-14(29)19-10-6-4-3-5-9(10)15(16,17)18/h3-8H,1-2H3,(H,20,25)(H2,19,21,29) |
| InChIKey | BGQNJIKLXWJBMM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|