C17H13FN6O4S2 — CID 19687409
1-(4-fluoro-2-nitrophenyl)-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 19687409) has the molecular formula C17H13FN6O4S2 and a molecular weight of 448.46 g/mol. Its IUPAC name is 1-(4-fluoro-2-nitrophenyl)-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(4-fluoro-2-nitrophenyl)-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19687409 |
| Molecular Formula | C17H13FN6O4S2 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 1-(4-fluoro-2-nitrophenyl)-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | O=[N+]([O-])c1cc(F)ccc1NC(=S)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1 |
| InChI | InChI=1S/C17H13FN6O4S2/c18-11-2-7-14(15(10-11)24(25)26)22-17(29)21-12-3-5-13(6-4-12)30(27,28)23-16-19-8-1-9-20-16/h1-10H,(H,19,20,23)(H2,21,22,29) |
| InChIKey | RYNQBNBGOGKUTM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|