C24H22N6O4S3 — CID 19678783
1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 19678783) has the molecular formula C24H22N6O4S3 and a molecular weight of 554.68 g/mol. Its IUPAC name is 1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19678783 |
| Molecular Formula | C24H22N6O4S3 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 1-[4-[(2-methylphenyl)sulfamoyl]phenyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(NC(=S)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc1 |
| InChI | InChI=1S/C24H22N6O4S3/c1-17-5-2-3-6-22(17)29-36(31,32)20-11-7-18(8-12-20)27-24(35)28-19-9-13-21(14-10-19)37(33,34)30-23-25-15-4-16-26-23/h2-16,29H,1H3,(H,25,26,30)(H2,27,28,35) |
| InChIKey | ZLBKAUKWHBCKAH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 142.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|