C21H19N3O4S2 — CID 17374728
1-(1,3-benzodioxol-5-yl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea (PubChem CID 17374728) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 17374728 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[4-[(2-methylphenyl)sulfamoyl]phenyl]thiourea |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc(NC(=S)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C21H19N3O4S2/c1-14-4-2-3-5-18(14)24-30(25,26)17-9-6-15(7-10-17)22-21(29)23-16-8-11-19-20(12-16)28-13-27-19/h2-12,24H,13H2,1H3,(H2,22,23,29) |
| InChIKey | WWLMZZBLJGJQLN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|