C14H12N4O6S2 — CID 17374353
1-(1,3-benzodioxol-5-yl)-3-[(4-nitrophenyl)sulfonylamino]thiourea (PubChem CID 17374353) has the molecular formula C14H12N4O6S2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[(4-nitrophenyl)sulfonylamino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[(4-nitrophenyl)sulfonylamino]thiourea |
|---|---|
| PubChem CID | 17374353 |
| Molecular Formula | C14H12N4O6S2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[(4-nitrophenyl)sulfonylamino]thiourea |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NNC(=S)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C14H12N4O6S2/c19-18(20)10-2-4-11(5-3-10)26(21,22)17-16-14(25)15-9-1-6-12-13(7-9)24-8-23-12/h1-7,17H,8H2,(H2,15,16,25) |
| InChIKey | HYOZRBPHGFQPCE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|