C18H20N2O4S2 — CID 133216677
1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylsulfonylphenyl)propyl]thiourea (PubChem CID 133216677) has the molecular formula C18H20N2O4S2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylsulfonylphenyl)propyl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylsulfonylphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 133216677 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(4-methylsulfonylphenyl)propyl]thiourea |
| SMILES | CCC(NC(=S)Nc1ccc2c(c1)OCO2)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C18H20N2O4S2/c1-3-15(12-4-7-14(8-5-12)26(2,21)22)20-18(25)19-13-6-9-16-17(10-13)24-11-23-16/h4-10,15H,3,11H2,1-2H3,(H2,19,20,25) |
| InChIKey | JYZOKKRVRNTHKG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|