C20H23ClN2O4S2 — CID 100735773
ethyl 2-chloro-4-[[(1R)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate (PubChem CID 100735773) has the molecular formula C20H23ClN2O4S2 and a molecular weight of 455.00 g/mol. Its IUPAC name is ethyl 2-chloro-4-[[(1R)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 2-chloro-4-[[(1R)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100735773 |
| Molecular Formula | C20H23ClN2O4S2 |
| Molecular Weight | 455.00 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | ethyl 2-chloro-4-[[(1R)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)N[C@H](CC)c2ccc(S(C)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C20H23ClN2O4S2/c1-4-18(13-6-9-15(10-7-13)29(3,25)26)23-20(28)22-14-8-11-16(17(21)12-14)19(24)27-5-2/h6-12,18H,4-5H2,1-3H3,(H2,22,23,28)/t18-/m1/s1 |
| InChIKey | JKWVSXDCCVEZEU-GOSISDBHSA-N |
| XLogP | 4.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.00 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|