C20H24N2O4S2 — CID 100735642
ethyl 3-[[(1S)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate (PubChem CID 100735642) has the molecular formula C20H24N2O4S2 and a molecular weight of 420.56 g/mol. Its IUPAC name is ethyl 3-[[(1S)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 3-[[(1S)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100735642 |
| Molecular Formula | C20H24N2O4S2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | ethyl 3-[[(1S)-1-(4-methylsulfonylphenyl)propyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)N[C@@H](CC)c2ccc(S(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C20H24N2O4S2/c1-4-18(14-9-11-17(12-10-14)28(3,24)25)22-20(27)21-16-8-6-7-15(13-16)19(23)26-5-2/h6-13,18H,4-5H2,1-3H3,(H2,21,22,27)/t18-/m0/s1 |
| InChIKey | PSDLJETURWOJHS-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|