C18H19FN2O2S — CID 133215346
ethyl 3-[1-(4-fluorophenyl)ethylcarbamothioylamino]benzoate (PubChem CID 133215346) has the molecular formula C18H19FN2O2S and a molecular weight of 346.43 g/mol. Its IUPAC name is ethyl 3-[1-(4-fluorophenyl)ethylcarbamothioylamino]benzoate.
| Compound Name | ethyl 3-[1-(4-fluorophenyl)ethylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 133215346 |
| Molecular Formula | C18H19FN2O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | ethyl 3-[1-(4-fluorophenyl)ethylcarbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)NC(C)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H19FN2O2S/c1-3-23-17(22)14-5-4-6-16(11-14)21-18(24)20-12(2)13-7-9-15(19)10-8-13/h4-12H,3H2,1-2H3,(H2,20,21,24) |
| InChIKey | ZDQFFCCUGHCTLM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|