C20H24N2O2S — CID 100670557
ethyl 3-[[(1R)-1-(2,5-dimethylphenyl)ethyl]carbamothioylamino]benzoate (PubChem CID 100670557) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is ethyl 3-[[(1R)-1-(2,5-dimethylphenyl)ethyl]carbamothioylamino]benzoate.
| Compound Name | ethyl 3-[[(1R)-1-(2,5-dimethylphenyl)ethyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100670557 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | ethyl 3-[[(1R)-1-(2,5-dimethylphenyl)ethyl]carbamothioylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=S)N[C@H](C)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C20H24N2O2S/c1-5-24-19(23)16-7-6-8-17(12-16)22-20(25)21-15(4)18-11-13(2)9-10-14(18)3/h6-12,15H,5H2,1-4H3,(H2,21,22,25)/t15-/m1/s1 |
| InChIKey | MXEHLNCDBOIDLG-OAHLLOKOSA-N |
| XLogP | 4.53 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|