C19H22N2OS — CID 19675250
1-(3-acetylphenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea (PubChem CID 19675250) has the molecular formula C19H22N2OS and a molecular weight of 326.47 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea.
| Compound Name | 1-(3-acetylphenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 19675250 |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[1-(2,4-dimethylphenyl)ethyl]thiourea |
| SMILES | CC(=O)c1cccc(NC(=S)NC(C)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H22N2OS/c1-12-8-9-18(13(2)10-12)14(3)20-19(23)21-17-7-5-6-16(11-17)15(4)22/h5-11,14H,1-4H3,(H2,20,21,23) |
| InChIKey | ZHVTWIYEBQYHIA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|