C18H22N2O3S — CID 92676500
N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(methanesulfonamido)benzamide (PubChem CID 92676500) has the molecular formula C18H22N2O3S and a molecular weight of 346.45 g/mol. Its IUPAC name is N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(methanesulfonamido)benzamide.
| Compound Name | N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 92676500 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[(1R)-1-(2,4-dimethylphenyl)ethyl]-3-(methanesulfonamido)benzamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2cccc(NS(C)(=O)=O)c2)c(C)c1 |
| InChI | InChI=1S/C18H22N2O3S/c1-12-8-9-17(13(2)10-12)14(3)19-18(21)15-6-5-7-16(11-15)20-24(4,22)23/h5-11,14,20H,1-4H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | NGFUUVDCSZFHRO-CQSZACIVSA-N |
| XLogP | 3.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |