C18H22N2O — CID 27474756
1-[(1S)-1-(2,4-dimethylphenyl)ethyl]-3-(3-methylphenyl)urea (PubChem CID 27474756) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-[(1S)-1-(2,4-dimethylphenyl)ethyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[(1S)-1-(2,4-dimethylphenyl)ethyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 27474756 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-[(1S)-1-(2,4-dimethylphenyl)ethyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)N[C@@H](C)c2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C18H22N2O/c1-12-6-5-7-16(11-12)20-18(21)19-15(4)17-9-8-13(2)10-14(17)3/h5-11,15H,1-4H3,(H2,19,20,21)/t15-/m0/s1 |
| InChIKey | MTJAZLOKMVCSIB-HNNXBMFYSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |