C18H19F3N2S — CID 17298996
1-[1-(2,4-dimethylphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 17298996) has the molecular formula C18H19F3N2S and a molecular weight of 352.43 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[1-(2,4-dimethylphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 17298996 |
| Molecular Formula | C18H19F3N2S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[1-(2,4-dimethylphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | Cc1ccc(C(C)NC(=S)Nc2cccc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C18H19F3N2S/c1-11-7-8-16(12(2)9-11)13(3)22-17(24)23-15-6-4-5-14(10-15)18(19,20)21/h4-10,13H,1-3H3,(H2,22,23,24) |
| InChIKey | HDADOCGXLHWHIM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|