C20H21F3N2O2 — CID 43906797
N-[3-(trifluoromethyl)phenyl]-N'-[1-(2,4,5-trimethylphenyl)ethyl]oxamide (PubChem CID 43906797) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-[3-(trifluoromethyl)phenyl]-N'-[1-(2,4,5-trimethylphenyl)ethyl]oxamide.
| Compound Name | N-[3-(trifluoromethyl)phenyl]-N'-[1-(2,4,5-trimethylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 43906797 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-[3-(trifluoromethyl)phenyl]-N'-[1-(2,4,5-trimethylphenyl)ethyl]oxamide |
| SMILES | Cc1cc(C)c(C(C)NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C20H21F3N2O2/c1-11-8-13(3)17(9-12(11)2)14(4)24-18(26)19(27)25-16-7-5-6-15(10-16)20(21,22)23/h5-10,14H,1-4H3,(H,24,26)(H,25,27) |
| InChIKey | LPUHXPYUCFZVDT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|