C21H26N2O2 — CID 30405095
N-[(1S)-1-phenylethyl]-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide (PubChem CID 30405095) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[(1S)-1-phenylethyl]-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide.
| Compound Name | N-[(1S)-1-phenylethyl]-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 30405095 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[(1S)-1-phenylethyl]-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide |
| SMILES | Cc1cc(C)c([C@@H](C)NC(=O)C(=O)N[C@@H](C)c2ccccc2)cc1C |
| InChI | InChI=1S/C21H26N2O2/c1-13-11-15(3)19(12-14(13)2)17(5)23-21(25)20(24)22-16(4)18-9-7-6-8-10-18/h6-12,16-17H,1-5H3,(H,22,24)(H,23,25)/t16-,17+/m0/s1 |
| InChIKey | NKVNOFIWKHVUMT-DLBZAZTESA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|