C18H22N2O3 — CID 30405111
N-(furan-2-ylmethyl)-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide (PubChem CID 30405111) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide.
| Compound Name | N-(furan-2-ylmethyl)-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 30405111 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]oxamide |
| SMILES | Cc1cc(C)c([C@@H](C)NC(=O)C(=O)NCc2ccco2)cc1C |
| InChI | InChI=1S/C18H22N2O3/c1-11-8-13(3)16(9-12(11)2)14(4)20-18(22)17(21)19-10-15-6-5-7-23-15/h5-9,14H,10H2,1-4H3,(H,19,21)(H,20,22)/t14-/m1/s1 |
| InChIKey | CNMLSGRONRTDRC-CQSZACIVSA-N |
| XLogP | 2.70 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|