C15H15NO3 — CID 82120685
2-(2,4-dimethylphenyl)-N-(furan-2-ylmethyl)-2-oxoacetamide (PubChem CID 82120685) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-(furan-2-ylmethyl)-2-oxoacetamide.
| Compound Name | 2-(2,4-dimethylphenyl)-N-(furan-2-ylmethyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 82120685 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-(furan-2-ylmethyl)-2-oxoacetamide |
| SMILES | Cc1ccc(C(=O)C(=O)NCc2ccco2)c(C)c1 |
| InChI | InChI=1S/C15H15NO3/c1-10-5-6-13(11(2)8-10)14(17)15(18)16-9-12-4-3-7-19-12/h3-8H,9H2,1-2H3,(H,16,18) |
| InChIKey | ZXAGGZYIPDXELG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|