C16H19NO2 — CID 30402622
N-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]furan-2-carboxamide (PubChem CID 30402622) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is N-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]furan-2-carboxamide.
| Compound Name | N-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30402622 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[(1R)-1-(2,4,5-trimethylphenyl)ethyl]furan-2-carboxamide |
| SMILES | Cc1cc(C)c([C@@H](C)NC(=O)c2ccco2)cc1C |
| InChI | InChI=1S/C16H19NO2/c1-10-8-12(3)14(9-11(10)2)13(4)17-16(18)15-6-5-7-19-15/h5-9,13H,1-4H3,(H,17,18)/t13-/m1/s1 |
| InChIKey | QLFNZVLRQWSVQE-CYBMUJFWSA-N |
| XLogP | 3.70 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |