C15H13NO3 — CID 41095457
N-[(1S)-1-(1-benzofuran-2-yl)ethyl]furan-2-carboxamide (PubChem CID 41095457) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is N-[(1S)-1-(1-benzofuran-2-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 41095457 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[(1S)-1-(1-benzofuran-2-yl)ethyl]furan-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1ccco1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C15H13NO3/c1-10(16-15(17)13-7-4-8-18-13)14-9-11-5-2-3-6-12(11)19-14/h2-10H,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | PEPYMTIRSGDSER-JTQLQIEISA-N |
| XLogP | 3.52 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |