C20H16N2O4S — CID 31310103
N-[5-[[(1R)-1-(1-benzofuran-2-yl)ethyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 31310103) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[5-[[(1R)-1-(1-benzofuran-2-yl)ethyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[[(1R)-1-(1-benzofuran-2-yl)ethyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31310103 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | N-[5-[[(1R)-1-(1-benzofuran-2-yl)ethyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc(NC(=O)c2ccco2)s1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C20H16N2O4S/c1-12(16-11-13-5-2-3-6-14(13)26-16)21-20(24)17-8-9-18(27-17)22-19(23)15-7-4-10-25-15/h2-12H,1H3,(H,21,24)(H,22,23)/t12-/m1/s1 |
| InChIKey | SRJSMKJDVKYTQX-GFCCVEGCSA-N |
| XLogP | 4.83 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |