C20H19ClN2O3S — CID 46420472
N-[5-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 46420472) has the molecular formula C20H19ClN2O3S and a molecular weight of 402.90 g/mol. Its IUPAC name is N-[5-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46420472 |
| Molecular Formula | C20H19ClN2O3S |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-[5-[[1-(4-chlorophenyl)-2-methylpropyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1ccc(NC(=O)c2ccco2)s1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H19ClN2O3S/c1-12(2)18(13-5-7-14(21)8-6-13)23-20(25)16-9-10-17(27-16)22-19(24)15-4-3-11-26-15/h3-12,18H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | FEONVXFPENJLFZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |