C17H12ClN3O4S — CID 51330523
N-[5-[[(2-chlorobenzoyl)amino]carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 51330523) has the molecular formula C17H12ClN3O4S and a molecular weight of 389.82 g/mol. Its IUPAC name is N-[5-[[(2-chlorobenzoyl)amino]carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[[(2-chlorobenzoyl)amino]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51330523 |
| Molecular Formula | C17H12ClN3O4S |
| Molecular Weight | 389.82 g/mol |
| Exact Mass | 389.02 |
| IUPAC Name | N-[5-[[(2-chlorobenzoyl)amino]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)NNC(=O)c2ccccc2Cl)s1)c1ccco1 |
| InChI | InChI=1S/C17H12ClN3O4S/c18-11-5-2-1-4-10(11)15(22)20-21-17(24)13-7-8-14(26-13)19-16(23)12-6-3-9-25-12/h1-9H,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | JPLTVPUQDODSEU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|