C16H11BrN2O3S — CID 134024197
N-[5-[(2-bromophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 134024197) has the molecular formula C16H11BrN2O3S and a molecular weight of 391.25 g/mol. Its IUPAC name is N-[5-[(2-bromophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(2-bromophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134024197 |
| Molecular Formula | C16H11BrN2O3S |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | N-[5-[(2-bromophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2ccccc2Br)s1)c1ccco1 |
| InChI | InChI=1S/C16H11BrN2O3S/c17-10-4-1-2-5-11(10)18-16(21)13-7-8-14(23-13)19-15(20)12-6-3-9-22-12/h1-9H,(H,18,21)(H,19,20) |
| InChIKey | PJPFGDDUFYMGCX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |