C18H16N4O4S — CID 46518431
N-[5-[[4-(methylcarbamoylamino)phenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 46518431) has the molecular formula C18H16N4O4S and a molecular weight of 384.42 g/mol. Its IUPAC name is N-[5-[[4-(methylcarbamoylamino)phenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[[4-(methylcarbamoylamino)phenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46518431 |
| Molecular Formula | C18H16N4O4S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[5-[[4-(methylcarbamoylamino)phenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | CNC(=O)Nc1ccc(NC(=O)c2ccc(NC(=O)c3ccco3)s2)cc1 |
| InChI | InChI=1S/C18H16N4O4S/c1-19-18(25)21-12-6-4-11(5-7-12)20-17(24)14-8-9-15(27-14)22-16(23)13-3-2-10-26-13/h2-10H,1H3,(H,20,24)(H,22,23)(H2,19,21,25) |
| InChIKey | CISMGSBUIFTUQC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |