C20H18N2O5S — CID 31306580
propan-2-yl 4-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate (PubChem CID 31306580) has the molecular formula C20H18N2O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is propan-2-yl 4-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate.
| Compound Name | propan-2-yl 4-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 31306580 |
| Molecular Formula | C20H18N2O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | propan-2-yl 4-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NC(=O)c2ccc(NC(=O)c3ccco3)s2)cc1 |
| InChI | InChI=1S/C20H18N2O5S/c1-12(2)27-20(25)13-5-7-14(8-6-13)21-19(24)16-9-10-17(28-16)22-18(23)15-4-3-11-26-15/h3-12H,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | NEYLWXHSTYICIS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |