C18H14N2O5S — CID 134024119
methyl 2-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate (PubChem CID 134024119) has the molecular formula C18H14N2O5S and a molecular weight of 370.39 g/mol. Its IUPAC name is methyl 2-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 134024119 |
| Molecular Formula | C18H14N2O5S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | methyl 2-[[5-(furan-2-carbonylamino)thiophene-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C18H14N2O5S/c1-24-18(23)11-5-2-3-6-12(11)19-17(22)14-8-9-15(26-14)20-16(21)13-7-4-10-25-13/h2-10H,1H3,(H,19,22)(H,20,21) |
| InChIKey | LVFRMPLUVJDDOM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |