C16H10ClFN2O3S — CID 31302478
N-[5-[(4-chloro-2-fluorophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 31302478) has the molecular formula C16H10ClFN2O3S and a molecular weight of 364.79 g/mol. Its IUPAC name is N-[5-[(4-chloro-2-fluorophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(4-chloro-2-fluorophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31302478 |
| Molecular Formula | C16H10ClFN2O3S |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | N-[5-[(4-chloro-2-fluorophenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2ccc(Cl)cc2F)s1)c1ccco1 |
| InChI | InChI=1S/C16H10ClFN2O3S/c17-9-3-4-11(10(18)8-9)19-16(22)13-5-6-14(24-13)20-15(21)12-2-1-7-23-12/h1-8H,(H,19,22)(H,20,21) |
| InChIKey | SNZXWQPRNXAUFE-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |