C18H14ClFN2O3S — CID 51330714
N-[5-[(2-chloro-6-fluorophenyl)methyl-methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 51330714) has the molecular formula C18H14ClFN2O3S and a molecular weight of 392.84 g/mol. Its IUPAC name is N-[5-[(2-chloro-6-fluorophenyl)methyl-methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(2-chloro-6-fluorophenyl)methyl-methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51330714 |
| Molecular Formula | C18H14ClFN2O3S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | N-[5-[(2-chloro-6-fluorophenyl)methyl-methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)c1ccc(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C18H14ClFN2O3S/c1-22(10-11-12(19)4-2-5-13(11)20)18(24)15-7-8-16(26-15)21-17(23)14-6-3-9-25-14/h2-9H,10H2,1H3,(H,21,23) |
| InChIKey | RMYNENGBSHTUEA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |