C14H16N2O4S — CID 51330650
N-[5-(3-methoxypropylcarbamoyl)thiophen-2-yl]furan-2-carboxamide (PubChem CID 51330650) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[5-(3-methoxypropylcarbamoyl)thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-(3-methoxypropylcarbamoyl)thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 51330650 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[5-(3-methoxypropylcarbamoyl)thiophen-2-yl]furan-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(NC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C14H16N2O4S/c1-19-8-3-7-15-14(18)11-5-6-12(21-11)16-13(17)10-4-2-9-20-10/h2,4-6,9H,3,7-8H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | JDJGWZKIVCZIJC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|