C16H18N2O4S — CID 111471137
N-[5-[(2-hydroxycyclopentyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 111471137) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is N-[5-[(2-hydroxycyclopentyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(2-hydroxycyclopentyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111471137 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[5-[(2-hydroxycyclopentyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)NCC2CCCC2O)s1)c1ccco1 |
| InChI | InChI=1S/C16H18N2O4S/c19-11-4-1-3-10(11)9-17-16(21)13-6-7-14(23-13)18-15(20)12-5-2-8-22-12/h2,5-8,10-11,19H,1,3-4,9H2,(H,17,21)(H,18,20) |
| InChIKey | CSQZCPIOYPFSLQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |