C18H13N3O3S — CID 94049859
N-[5-[(3-cyanophenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 94049859) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is N-[5-[(3-cyanophenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(3-cyanophenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 94049859 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | N-[5-[(3-cyanophenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | N#Cc1cccc(CNC(=O)c2ccc(NC(=O)c3ccco3)s2)c1 |
| InChI | InChI=1S/C18H13N3O3S/c19-10-12-3-1-4-13(9-12)11-20-18(23)15-6-7-16(25-15)21-17(22)14-5-2-8-24-14/h1-9H,11H2,(H,20,23)(H,21,22) |
| InChIKey | ZVPHXSAEHSVZFR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |