C22H23N3O5S2 — CID 46593393
N-[5-[(4-piperidin-1-ylsulfonylphenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 46593393) has the molecular formula C22H23N3O5S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[5-[(4-piperidin-1-ylsulfonylphenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(4-piperidin-1-ylsulfonylphenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 46593393 |
| Molecular Formula | C22H23N3O5S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-[5-[(4-piperidin-1-ylsulfonylphenyl)methylcarbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)NCc2ccc(S(=O)(=O)N3CCCCC3)cc2)s1)c1ccco1 |
| InChI | InChI=1S/C22H23N3O5S2/c26-21(18-5-4-14-30-18)24-20-11-10-19(31-20)22(27)23-15-16-6-8-17(9-7-16)32(28,29)25-12-2-1-3-13-25/h4-11,14H,1-3,12-13,15H2,(H,23,27)(H,24,26) |
| InChIKey | ZIMDLQUMFLCYBL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |