C22H24N4O4S — CID 30756951
N-[4-[[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 30756951) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[4-[[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30756951 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[4-[[(5-piperidin-1-ylsulfonyl-2-pyridinyl)amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(CNc2ccc(S(=O)(=O)N3CCCCC3)cn2)cc1)c1ccco1 |
| InChI | InChI=1S/C22H24N4O4S/c27-22(20-5-4-14-30-20)25-18-8-6-17(7-9-18)15-23-21-11-10-19(16-24-21)31(28,29)26-12-2-1-3-13-26/h4-11,14,16H,1-3,12-13,15H2,(H,23,24)(H,25,27) |
| InChIKey | VKBAVCWZBGSZJC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |