C24H26N4O6S — CID 32876147
N-[3-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]phenyl]furan-2-carboxamide (PubChem CID 32876147) has the molecular formula C24H26N4O6S and a molecular weight of 498.56 g/mol. Its IUPAC name is N-[3-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 32876147 |
| Molecular Formula | C24H26N4O6S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-[3-[[4-(azepan-1-ylsulfonyl)-2-nitroanilino]methyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(CNc2ccc(S(=O)(=O)N3CCCCCC3)cc2[N+](=O)[O-])c1)c1ccco1 |
| InChI | InChI=1S/C24H26N4O6S/c29-24(23-9-6-14-34-23)26-19-8-5-7-18(15-19)17-25-21-11-10-20(16-22(21)28(30)31)35(32,33)27-12-3-1-2-4-13-27/h5-11,14-16,25H,1-4,12-13,17H2,(H,26,29) |
| InChIKey | MSFSANCVVKRSDS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 134.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|