C17H22N4O5S — CID 133271890
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline (PubChem CID 133271890) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline.
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 133271890 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
| SMILES | Cc1nc(CNc2ccc(S(=O)(=O)N3CCCCC3)cc2[N+](=O)[O-])oc1C |
| InChI | InChI=1S/C17H22N4O5S/c1-12-13(2)26-17(19-12)11-18-15-7-6-14(10-16(15)21(22)23)27(24,25)20-8-4-3-5-9-20/h6-7,10,18H,3-5,8-9,11H2,1-2H3 |
| InChIKey | FUPVZZSTFAZPTL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|