C21H25N5O4S — CID 133480247
N-[(1,5-dimethylbenzimidazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline (PubChem CID 133480247) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[(1,5-dimethylbenzimidazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline.
| Compound Name | N-[(1,5-dimethylbenzimidazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
|---|---|
| PubChem CID | 133480247 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-[(1,5-dimethylbenzimidazol-2-yl)methyl]-2-nitro-4-piperidin-1-ylsulfonylaniline |
| SMILES | Cc1ccc2c(c1)nc(CNc1ccc(S(=O)(=O)N3CCCCC3)cc1[N+](=O)[O-])n2C |
| InChI | InChI=1S/C21H25N5O4S/c1-15-6-9-19-18(12-15)23-21(24(19)2)14-22-17-8-7-16(13-20(17)26(27)28)31(29,30)25-10-4-3-5-11-25/h6-9,12-13,22H,3-5,10-11,14H2,1-2H3 |
| InChIKey | LSSALXHZKHSTEM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 110.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|