C20H28N4O5S — CID 133342106
4-(azepan-1-ylsulfonyl)-N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline (PubChem CID 133342106) has the molecular formula C20H28N4O5S and a molecular weight of 436.53 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline |
|---|---|
| PubChem CID | 133342106 |
| Molecular Formula | C20H28N4O5S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-nitroaniline |
| SMILES | CC(C)(C)c1cnc(CNc2ccc(S(=O)(=O)N3CCCCCC3)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C20H28N4O5S/c1-20(2,3)18-13-22-19(29-18)14-21-16-9-8-15(12-17(16)24(25)26)30(27,28)23-10-6-4-5-7-11-23/h8-9,12-13,21H,4-7,10-11,14H2,1-3H3 |
| InChIKey | GVVZXRRQQZVKMK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|