C14H16N4O5 — CID 133342087
N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2,4-dinitroaniline (PubChem CID 133342087) has the molecular formula C14H16N4O5 and a molecular weight of 320.31 g/mol. Its IUPAC name is N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2,4-dinitroaniline.
| Compound Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 133342087 |
| Molecular Formula | C14H16N4O5 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2,4-dinitroaniline |
| SMILES | CC(C)(C)c1cnc(CNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C14H16N4O5/c1-14(2,3)12-7-16-13(23-12)8-15-10-5-4-9(17(19)20)6-11(10)18(21)22/h4-7,15H,8H2,1-3H3 |
| InChIKey | DWSDTZHKVWSARB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|